C34H38O14S4 — CID 10557292
[(2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate (PubChem CID 10557292) has the molecular formula C34H38O14S4 and a molecular weight of 798.93 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10557292 |
| Molecular Formula | C34H38O14S4 |
| Molecular Weight | 798.93 g/mol |
| Exact Mass | 798.11 |
| IUPAC Name | [(2R,3R,4R,5R)-2,5-dihydroxy-3,4,6-tris-(4-methylphenyl)sulfonyloxyhexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@H](OS(=O)(=O)c2ccc(C)cc2)[C@H](O)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C34H38O14S4/c1-23-5-13-27(14-6-23)49(37,38)45-21-31(35)33(47-51(41,42)29-17-9-25(3)10-18-29)34(48-52(43,44)30-19-11-26(4)12-20-30)32(36)22-46-50(39,40)28-15-7-24(2)8-16-28/h5-20,31-36H,21-22H2,1-4H3/t31-,32-,33-,34-/m1/s1 |
| InChIKey | SALRRBVOEPXQRL-YFRBGRBWSA-N |
| XLogP | 3.30 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.93 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|