C18H22O6S2 — CID 143952282
[2,3-dihydroxy-4-(4-methylphenyl)sulfanyloxybutyl] 4-methylbenzenesulfonate (PubChem CID 143952282) has the molecular formula C18H22O6S2 and a molecular weight of 398.50 g/mol. Its IUPAC name is [2,3-dihydroxy-4-(4-methylphenyl)sulfanyloxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [2,3-dihydroxy-4-(4-methylphenyl)sulfanyloxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 143952282 |
| Molecular Formula | C18H22O6S2 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [2,3-dihydroxy-4-(4-methylphenyl)sulfanyloxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(SOCC(O)C(O)COS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C18H22O6S2/c1-13-3-7-15(8-4-13)25-23-11-17(19)18(20)12-24-26(21,22)16-9-5-14(2)6-10-16/h3-10,17-20H,11-12H2,1-2H3 |
| InChIKey | JZBARPIQEZXDNV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|