C12H18O5S — CID 11403090
[(2S)-2,5-dihydroxypentyl] 4-methylbenzenesulfonate (PubChem CID 11403090) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is [(2S)-2,5-dihydroxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2,5-dihydroxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11403090 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [(2S)-2,5-dihydroxypentyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)CCCO)cc1 |
| InChI | InChI=1S/C12H18O5S/c1-10-4-6-12(7-5-10)18(15,16)17-9-11(14)3-2-8-13/h4-7,11,13-14H,2-3,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | VUWMFAHUSZZIPC-NSHDSACASA-N |
| XLogP | 0.83 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|