C19H34O5SSi — CID 134842478
[(2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhexyl] 4-methylbenzenesulfonate (PubChem CID 134842478) has the molecular formula C19H34O5SSi and a molecular weight of 402.63 g/mol. Its IUPAC name is [(2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhexyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhexyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134842478 |
| Molecular Formula | C19H34O5SSi |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [(2S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-hydroxyhexyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)CC[C@H](C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C19H34O5SSi/c1-15-8-12-18(13-9-15)25(21,22)23-14-17(20)11-10-16(2)24-26(6,7)19(3,4)5/h8-9,12-13,16-17,20H,10-11,14H2,1-7H3/t16-,17-/m0/s1 |
| InChIKey | FOJNLRBFDNQOBF-IRXDYDNUSA-N |
| XLogP | 4.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|