C25H38O5SSi — CID 90411478
[3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)butyl] 4-methylbenzenesulfonate (PubChem CID 90411478) has the molecular formula C25H38O5SSi and a molecular weight of 478.73 g/mol. Its IUPAC name is [3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)butyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)butyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90411478 |
| Molecular Formula | C25H38O5SSi |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)butyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(COCc2ccccc2)C(C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H38O5SSi/c1-20-13-15-24(16-14-20)31(26,27)29-19-23(18-28-17-22-11-9-8-10-12-22)21(2)30-32(6,7)25(3,4)5/h8-16,21,23H,17-19H2,1-7H3 |
| InChIKey | OVLMFHXZAOCEIK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|