C20H25ClO6S — CID 87551567
[(2R)-3-[(2R)-1-chloro-3-phenylmethoxypropan-2-yl]oxy-2-hydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 87551567) has the molecular formula C20H25ClO6S and a molecular weight of 428.93 g/mol. Its IUPAC name is [(2R)-3-[(2R)-1-chloro-3-phenylmethoxypropan-2-yl]oxy-2-hydroxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-3-[(2R)-1-chloro-3-phenylmethoxypropan-2-yl]oxy-2-hydroxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87551567 |
| Molecular Formula | C20H25ClO6S |
| Molecular Weight | 428.93 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | [(2R)-3-[(2R)-1-chloro-3-phenylmethoxypropan-2-yl]oxy-2-hydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](O)CO[C@@H](CCl)COCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25ClO6S/c1-16-7-9-20(10-8-16)28(23,24)27-14-18(22)13-26-19(11-21)15-25-12-17-5-3-2-4-6-17/h2-10,18-19,22H,11-15H2,1H3/t18-,19+/m1/s1 |
| InChIKey | NCDDFWDZVXEQTQ-MOPGFXCFSA-N |
| XLogP | 2.90 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.93 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|