C25H28O7S2 — CID 15090137
[(3S)-4-(4-methylphenyl)sulfonyloxy-3-phenylmethoxybutyl] 4-methylbenzenesulfonate (PubChem CID 15090137) has the molecular formula C25H28O7S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is [(3S)-4-(4-methylphenyl)sulfonyloxy-3-phenylmethoxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(3S)-4-(4-methylphenyl)sulfonyloxy-3-phenylmethoxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15090137 |
| Molecular Formula | C25H28O7S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | [(3S)-4-(4-methylphenyl)sulfonyloxy-3-phenylmethoxybutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@@H](COS(=O)(=O)c2ccc(C)cc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H28O7S2/c1-20-8-12-24(13-9-20)33(26,27)31-17-16-23(30-18-22-6-4-3-5-7-22)19-32-34(28,29)25-14-10-21(2)11-15-25/h3-15,23H,16-19H2,1-2H3/t23-/m0/s1 |
| InChIKey | FCVQJLSXGJVOTO-QHCPKHFHSA-N |
| XLogP | 4.39 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|