C22H28O6S — CID 10251580
[(2S)-3-(oxan-2-yloxy)-2-phenylmethoxypropyl] 4-methylbenzenesulfonate (PubChem CID 10251580) has the molecular formula C22H28O6S and a molecular weight of 420.53 g/mol. Its IUPAC name is [(2S)-3-(oxan-2-yloxy)-2-phenylmethoxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-3-(oxan-2-yloxy)-2-phenylmethoxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10251580 |
| Molecular Formula | C22H28O6S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [(2S)-3-(oxan-2-yloxy)-2-phenylmethoxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](COC2CCCCO2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H28O6S/c1-18-10-12-21(13-11-18)29(23,24)28-17-20(16-27-22-9-5-6-14-25-22)26-15-19-7-3-2-4-8-19/h2-4,7-8,10-13,20,22H,5-6,9,14-17H2,1H3/t20-,22?/m0/s1 |
| InChIKey | ZCMUGGVQDKNFRT-AIBWNMTMSA-N |
| XLogP | 3.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|