C18H28O4 — CID 165127390
2-[2-[(3S)-3-phenylmethoxybutoxy]ethoxy]oxane (PubChem CID 165127390) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is 2-[2-[(3S)-3-phenylmethoxybutoxy]ethoxy]oxane.
| Compound Name | 2-[2-[(3S)-3-phenylmethoxybutoxy]ethoxy]oxane |
|---|---|
| PubChem CID | 165127390 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-[2-[(3S)-3-phenylmethoxybutoxy]ethoxy]oxane |
| SMILES | C[C@@H](CCOCCOC1CCCCO1)OCc1ccccc1 |
| InChI | InChI=1S/C18H28O4/c1-16(22-15-17-7-3-2-4-8-17)10-12-19-13-14-21-18-9-5-6-11-20-18/h2-4,7-8,16,18H,5-6,9-15H2,1H3/t16-,18?/m0/s1 |
| InChIKey | QHMWDJZYZYCAAA-ATNAJCNCSA-N |
| XLogP | 3.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|