C19H30O4 — CID 174209322
2-[1-(3-phenylmethoxybutoxy)propan-2-yloxy]oxane (PubChem CID 174209322) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is 2-[1-(3-phenylmethoxybutoxy)propan-2-yloxy]oxane.
| Compound Name | 2-[1-(3-phenylmethoxybutoxy)propan-2-yloxy]oxane |
|---|---|
| PubChem CID | 174209322 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 2-[1-(3-phenylmethoxybutoxy)propan-2-yloxy]oxane |
| SMILES | CC(CCOCC(C)OC1CCCCO1)OCc1ccccc1 |
| InChI | InChI=1S/C19H30O4/c1-16(22-15-18-8-4-3-5-9-18)11-13-20-14-17(2)23-19-10-6-7-12-21-19/h3-5,8-9,16-17,19H,6-7,10-15H2,1-2H3 |
| InChIKey | HTDNTFNWDANXER-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|