C20H31N3O3 — CID 52916436
2-[(5S,6S)-5-azido-6-phenylmethoxyoctoxy]oxane (PubChem CID 52916436) has the molecular formula C20H31N3O3 and a molecular weight of 361.49 g/mol. Its IUPAC name is 2-[(5S,6S)-5-azido-6-phenylmethoxyoctoxy]oxane.
| Compound Name | 2-[(5S,6S)-5-azido-6-phenylmethoxyoctoxy]oxane |
|---|---|
| PubChem CID | 52916436 |
| Molecular Formula | C20H31N3O3 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[(5S,6S)-5-azido-6-phenylmethoxyoctoxy]oxane |
| SMILES | CC[C@H](OCc1ccccc1)[C@H](CCCCOC1CCCCO1)N=[N+]=[N-] |
| InChI | InChI=1S/C20H31N3O3/c1-2-19(26-16-17-10-4-3-5-11-17)18(22-23-21)12-6-8-14-24-20-13-7-9-15-25-20/h3-5,10-11,18-20H,2,6-9,12-16H2,1H3/t18-,19-,20?/m0/s1 |
| InChIKey | QNUBCODHLDDIDF-NFBCFJMWSA-N |
| XLogP | 5.37 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|