C17H19NO5S — CID 137363706
benzyl (2S)-2-amino-3-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 137363706) has the molecular formula C17H19NO5S and a molecular weight of 349.41 g/mol. Its IUPAC name is benzyl (2S)-2-amino-3-(4-methylphenyl)sulfonyloxypropanoate.
| Compound Name | benzyl (2S)-2-amino-3-(4-methylphenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 137363706 |
| Molecular Formula | C17H19NO5S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | benzyl (2S)-2-amino-3-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](N)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C17H19NO5S/c1-13-7-9-15(10-8-13)24(20,21)23-12-16(18)17(19)22-11-14-5-3-2-4-6-14/h2-10,16H,11-12,18H2,1H3/t16-/m0/s1 |
| InChIKey | HKSNNAYHEDPELA-INIZCTEOSA-N |
| XLogP | 1.77 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|