C21H26O5S — CID 87909464
tert-butyl (2R)-2-benzyl-3-(4-methylphenyl)sulfonyloxypropanoate (PubChem CID 87909464) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is tert-butyl (2R)-2-benzyl-3-(4-methylphenyl)sulfonyloxypropanoate.
| Compound Name | tert-butyl (2R)-2-benzyl-3-(4-methylphenyl)sulfonyloxypropanoate |
|---|---|
| PubChem CID | 87909464 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | tert-butyl (2R)-2-benzyl-3-(4-methylphenyl)sulfonyloxypropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](Cc2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C21H26O5S/c1-16-10-12-19(13-11-16)27(23,24)25-15-18(20(22)26-21(2,3)4)14-17-8-6-5-7-9-17/h5-13,18H,14-15H2,1-4H3/t18-/m1/s1 |
| InChIKey | ILMCGHVYRPJVHH-GOSISDBHSA-N |
| XLogP | 3.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|