C17H21NO3S — CID 129254230
[(2S)-2-(methylamino)-3-phenylpropyl] 4-methylbenzenesulfonate (PubChem CID 129254230) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is [(2S)-2-(methylamino)-3-phenylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-2-(methylamino)-3-phenylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 129254230 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [(2S)-2-(methylamino)-3-phenylpropyl] 4-methylbenzenesulfonate |
| SMILES | CN[C@H](COS(=O)(=O)c1ccc(C)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO3S/c1-14-8-10-17(11-9-14)22(19,20)21-13-16(18-2)12-15-6-4-3-5-7-15/h3-11,16,18H,12-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | GQLCMFXRQXPWRA-INIZCTEOSA-N |
| XLogP | 2.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|