C20H20O3S2 — CID 102000035
[(2R)-3-phenyl-2-thiophen-2-ylpropyl] 4-methylbenzenesulfonate (PubChem CID 102000035) has the molecular formula C20H20O3S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(2R)-3-phenyl-2-thiophen-2-ylpropyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R)-3-phenyl-2-thiophen-2-ylpropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102000035 |
| Molecular Formula | C20H20O3S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | [(2R)-3-phenyl-2-thiophen-2-ylpropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](Cc2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H20O3S2/c1-16-9-11-19(12-10-16)25(21,22)23-15-18(20-8-5-13-24-20)14-17-6-3-2-4-7-17/h2-13,18H,14-15H2,1H3/t18-/m1/s1 |
| InChIKey | YGVYWKZDXUKSBJ-GOSISDBHSA-N |
| XLogP | 4.79 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|