C30H30O6S2 — CID 13053257
[4-(4-methylphenyl)sulfonyloxy-2,3-diphenylbutyl] 4-methylbenzenesulfonate (PubChem CID 13053257) has the molecular formula C30H30O6S2 and a molecular weight of 550.70 g/mol. Its IUPAC name is [4-(4-methylphenyl)sulfonyloxy-2,3-diphenylbutyl] 4-methylbenzenesulfonate.
| Compound Name | [4-(4-methylphenyl)sulfonyloxy-2,3-diphenylbutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 13053257 |
| Molecular Formula | C30H30O6S2 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | [4-(4-methylphenyl)sulfonyloxy-2,3-diphenylbutyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(c2ccccc2)C(COS(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H30O6S2/c1-23-13-17-27(18-14-23)37(31,32)35-21-29(25-9-5-3-6-10-25)30(26-11-7-4-8-12-26)22-36-38(33,34)28-19-15-24(2)16-20-28/h3-20,29-30H,21-22H2,1-2H3 |
| InChIKey | PFXFMAXBCFUHFW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|