C19H24O5S — CID 87788497
[2-(2-methoxypropan-2-yloxy)-2-phenylethyl] 4-methylbenzenesulfonate (PubChem CID 87788497) has the molecular formula C19H24O5S and a molecular weight of 364.46 g/mol. Its IUPAC name is [2-(2-methoxypropan-2-yloxy)-2-phenylethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-(2-methoxypropan-2-yloxy)-2-phenylethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87788497 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | [2-(2-methoxypropan-2-yloxy)-2-phenylethyl] 4-methylbenzenesulfonate |
| SMILES | COC(C)(C)OC(COS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H24O5S/c1-15-10-12-17(13-11-15)25(20,21)23-14-18(24-19(2,3)22-4)16-8-6-5-7-9-16/h5-13,18H,14H2,1-4H3 |
| InChIKey | ZGFLQIWTRSAEFX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|