C16H28O4SSi — CID 76824489
2-[tert-butyl(dimethyl)silyl]oxypropyl 4-methylbenzenesulfonate (PubChem CID 76824489) has the molecular formula C16H28O4SSi and a molecular weight of 344.55 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxypropyl 4-methylbenzenesulfonate.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxypropyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 76824489 |
| Molecular Formula | C16H28O4SSi |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxypropyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(C)O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H28O4SSi/c1-13-8-10-15(11-9-13)21(17,18)19-12-14(2)20-22(6,7)16(3,4)5/h8-11,14H,12H2,1-7H3 |
| InChIKey | DSDREEAQWWVRMA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|