C26H46O5SSi — CID 46854952
[(E,2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,4-dimethyldec-7-enyl] 4-methylbenzenesulfonate (PubChem CID 46854952) has the molecular formula C26H46O5SSi and a molecular weight of 498.80 g/mol. Its IUPAC name is [(E,2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,4-dimethyldec-7-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E,2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,4-dimethyldec-7-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 46854952 |
| Molecular Formula | C26H46O5SSi |
| Molecular Weight | 498.80 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [(E,2S,3R,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-2,4-dimethyldec-7-enyl] 4-methylbenzenesulfonate |
| SMILES | CC/C=C/C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](OC)[C@@H](C)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H46O5SSi/c1-11-12-13-14-24(31-33(9,10)26(5,6)7)22(4)25(29-8)21(3)19-30-32(27,28)23-17-15-20(2)16-18-23/h12-13,15-18,21-22,24-25H,11,14,19H2,1-10H3/b13-12+/t21-,22-,24+,25+/m0/s1 |
| InChIKey | QGGJUFUIYMJYMT-VOSIRVQLSA-N |
| XLogP | 6.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.80 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|