C21H36O5SSi — CID 10950015
[(Z,2S,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-2-hydroxyhex-4-enyl] 4-methylbenzenesulfonate (PubChem CID 10950015) has the molecular formula C21H36O5SSi and a molecular weight of 428.67 g/mol. Its IUPAC name is [(Z,2S,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-2-hydroxyhex-4-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(Z,2S,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-2-hydroxyhex-4-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10950015 |
| Molecular Formula | C21H36O5SSi |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | [(Z,2S,3R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-2-hydroxyhex-4-enyl] 4-methylbenzenesulfonate |
| SMILES | CC[C@H](/C=C\CO[Si](C)(C)C(C)(C)C)[C@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H36O5SSi/c1-8-18(10-9-15-26-28(6,7)21(3,4)5)20(22)16-25-27(23,24)19-13-11-17(2)12-14-19/h9-14,18,20,22H,8,15-16H2,1-7H3/b10-9-/t18-,20-/m1/s1 |
| InChIKey | HRFNRQSNFBAWMB-UQKJKQERSA-N |
| XLogP | 4.67 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|