C24H46O6SSi2 — CID 101369421
[2,2-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxypropyl] 4-methylbenzenesulfonate (PubChem CID 101369421) has the molecular formula C24H46O6SSi2 and a molecular weight of 518.87 g/mol. Its IUPAC name is [2,2-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxypropyl] 4-methylbenzenesulfonate.
| Compound Name | [2,2-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxypropyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101369421 |
| Molecular Formula | C24H46O6SSi2 |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | [2,2-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxypropyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(CO)(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H46O6SSi2/c1-20-12-14-21(15-13-20)31(26,27)28-17-24(16-25,18-29-32(8,9)22(2,3)4)19-30-33(10,11)23(5,6)7/h12-15,25H,16-19H2,1-11H3 |
| InChIKey | OEJRENKLPCBIRO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|