C21H31NO4SSi — CID 87451557
2-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]ethyl 4-methylbenzenesulfonate (PubChem CID 87451557) has the molecular formula C21H31NO4SSi and a molecular weight of 421.64 g/mol. Its IUPAC name is 2-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87451557 |
| Molecular Formula | C21H31NO4SSi |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-pyridinyl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccc(CO[Si](C)(C)C(C)(C)C)nc2)cc1 |
| InChI | InChI=1S/C21H31NO4SSi/c1-17-7-11-20(12-8-17)27(23,24)25-14-13-18-9-10-19(22-15-18)16-26-28(5,6)21(2,3)4/h7-12,15H,13-14,16H2,1-6H3 |
| InChIKey | KSVJQEKDGGNRAY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|