C21H40N2OSi — CID 156732410
[5-[9-[tert-butyl(dimethyl)silyl]oxynonyl]-2-pyridinyl]methanamine (PubChem CID 156732410) has the molecular formula C21H40N2OSi and a molecular weight of 364.65 g/mol. Its IUPAC name is [5-[9-[tert-butyl(dimethyl)silyl]oxynonyl]-2-pyridinyl]methanamine.
| Compound Name | [5-[9-[tert-butyl(dimethyl)silyl]oxynonyl]-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 156732410 |
| Molecular Formula | C21H40N2OSi |
| Molecular Weight | 364.65 g/mol |
| Exact Mass | 364.29 |
| IUPAC Name | [5-[9-[tert-butyl(dimethyl)silyl]oxynonyl]-2-pyridinyl]methanamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCCCCCc1ccc(CN)nc1 |
| InChI | InChI=1S/C21H40N2OSi/c1-21(2,3)25(4,5)24-16-12-10-8-6-7-9-11-13-19-14-15-20(17-22)23-18-19/h14-15,18H,6-13,16-17,22H2,1-5H3 |
| InChIKey | DDERIOYKODFAMD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|