C26H36N2O2Si — CID 59678692
tert-butyl-dimethyl-[4-[4-(2-quinazolin-4-yloxyethyl)phenyl]butoxy]silane (PubChem CID 59678692) has the molecular formula C26H36N2O2Si and a molecular weight of 436.67 g/mol. Its IUPAC name is tert-butyl-dimethyl-[4-[4-(2-quinazolin-4-yloxyethyl)phenyl]butoxy]silane.
| Compound Name | tert-butyl-dimethyl-[4-[4-(2-quinazolin-4-yloxyethyl)phenyl]butoxy]silane |
|---|---|
| PubChem CID | 59678692 |
| Molecular Formula | C26H36N2O2Si |
| Molecular Weight | 436.67 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | tert-butyl-dimethyl-[4-[4-(2-quinazolin-4-yloxyethyl)phenyl]butoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCc1ccc(CCOc2ncnc3ccccc23)cc1 |
| InChI | InChI=1S/C26H36N2O2Si/c1-26(2,3)31(4,5)30-18-9-8-10-21-13-15-22(16-14-21)17-19-29-25-23-11-6-7-12-24(23)27-20-28-25/h6-7,11-16,20H,8-10,17-19H2,1-5H3 |
| InChIKey | MZQAQGGQIPMFHB-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.67 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|