C32H38OSi2 — CID 58097772
tert-butyl-dimethyl-[2-(4-triphenylsilylphenyl)ethoxy]silane (PubChem CID 58097772) has the molecular formula C32H38OSi2 and a molecular weight of 494.83 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-(4-triphenylsilylphenyl)ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-(4-triphenylsilylphenyl)ethoxy]silane |
|---|---|
| PubChem CID | 58097772 |
| Molecular Formula | C32H38OSi2 |
| Molecular Weight | 494.83 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | tert-butyl-dimethyl-[2-(4-triphenylsilylphenyl)ethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1ccc([Si](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C32H38OSi2/c1-32(2,3)34(4,5)33-26-25-27-21-23-31(24-22-27)35(28-15-9-6-10-16-28,29-17-11-7-12-18-29)30-19-13-8-14-20-30/h6-24H,25-26H2,1-5H3 |
| InChIKey | VMSLCLGLZATJQR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.83 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|