C33H47NO2Si — CID 11800072
4-butyl-N-[4-[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]ethyl]phenyl]-N-phenylaniline (PubChem CID 11800072) has the molecular formula C33H47NO2Si and a molecular weight of 517.83 g/mol. Its IUPAC name is 4-butyl-N-[4-[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]ethyl]phenyl]-N-phenylaniline.
| Compound Name | 4-butyl-N-[4-[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]ethyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 11800072 |
| Molecular Formula | C33H47NO2Si |
| Molecular Weight | 517.83 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | 4-butyl-N-[4-[2-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]ethyl]phenyl]-N-phenylaniline |
| SMILES | CCCCc1ccc(N(c2ccccc2)c2ccc(CCOCCCO[Si](C)(C)C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C33H47NO2Si/c1-7-8-13-28-16-20-31(21-17-28)34(30-14-10-9-11-15-30)32-22-18-29(19-23-32)24-27-35-25-12-26-36-37(5,6)33(2,3)4/h9-11,14-23H,7-8,12-13,24-27H2,1-6H3 |
| InChIKey | QBZIMYACXKSVKZ-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.83 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|