C24H47NO2Si2 — CID 10694288
N,N-bis[3-[tert-butyl(dimethyl)silyl]oxypropyl]aniline (PubChem CID 10694288) has the molecular formula C24H47NO2Si2 and a molecular weight of 437.82 g/mol. Its IUPAC name is N,N-bis[3-[tert-butyl(dimethyl)silyl]oxypropyl]aniline.
| Compound Name | N,N-bis[3-[tert-butyl(dimethyl)silyl]oxypropyl]aniline |
|---|---|
| PubChem CID | 10694288 |
| Molecular Formula | C24H47NO2Si2 |
| Molecular Weight | 437.82 g/mol |
| Exact Mass | 437.31 |
| IUPAC Name | N,N-bis[3-[tert-butyl(dimethyl)silyl]oxypropyl]aniline |
| SMILES | CC(C)(C)[Si](C)(C)OCCCN(CCCO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C24H47NO2Si2/c1-23(2,3)28(7,8)26-20-14-18-25(22-16-12-11-13-17-22)19-15-21-27-29(9,10)24(4,5)6/h11-13,16-17H,14-15,18-21H2,1-10H3 |
| InChIKey | LDXSOYWWPMRZLA-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.82 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|