C20H27NO2Si — CID 24809397
2-[tert-butyl(dimethyl)silyl]oxy-N,N-diphenylacetamide (PubChem CID 24809397) has the molecular formula C20H27NO2Si and a molecular weight of 341.53 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-N,N-diphenylacetamide.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-N,N-diphenylacetamide |
|---|---|
| PubChem CID | 24809397 |
| Molecular Formula | C20H27NO2Si |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-N,N-diphenylacetamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27NO2Si/c1-20(2,3)24(4,5)23-16-19(22)21(17-12-8-6-9-13-17)18-14-10-7-11-15-18/h6-15H,16H2,1-5H3 |
| InChIKey | RZBICEMJNGKDRI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|