C22H51NO4Si3 — CID 19851352
2-[tert-butyl(dimethyl)silyl]oxy-N,N-bis[[tert-butyl(dimethyl)silyl]oxymethyl]acetamide (PubChem CID 19851352) has the molecular formula C22H51NO4Si3 and a molecular weight of 477.91 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-N,N-bis[[tert-butyl(dimethyl)silyl]oxymethyl]acetamide.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-N,N-bis[[tert-butyl(dimethyl)silyl]oxymethyl]acetamide |
|---|---|
| PubChem CID | 19851352 |
| Molecular Formula | C22H51NO4Si3 |
| Molecular Weight | 477.91 g/mol |
| Exact Mass | 477.31 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-N,N-bis[[tert-butyl(dimethyl)silyl]oxymethyl]acetamide |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=O)N(CO[Si](C)(C)C(C)(C)C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H51NO4Si3/c1-20(2,3)28(10,11)25-16-19(24)23(17-26-29(12,13)21(4,5)6)18-27-30(14,15)22(7,8)9/h16-18H2,1-15H3 |
| InChIKey | ARNWROKJBBTRRQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.91 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|