C10H20BrNO2Si — CID 134964281
(Z)-3-bromo-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enamide (PubChem CID 134964281) has the molecular formula C10H20BrNO2Si and a molecular weight of 294.27 g/mol. Its IUPAC name is (Z)-3-bromo-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enamide.
| Compound Name | (Z)-3-bromo-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enamide |
|---|---|
| PubChem CID | 134964281 |
| Molecular Formula | C10H20BrNO2Si |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (Z)-3-bromo-2-[[tert-butyl(dimethyl)silyl]oxymethyl]prop-2-enamide |
| SMILES | CC(C)(C)[Si](C)(C)OC/C(=C/Br)C(N)=O |
| InChI | InChI=1S/C10H20BrNO2Si/c1-10(2,3)15(4,5)14-7-8(6-11)9(12)13/h6H,7H2,1-5H3,(H2,12,13)/b8-6- |
| InChIKey | HKGWLRBYOGPUPX-VURMDHGXSA-N |
| XLogP | 2.77 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|