C10H23NO4Si — CID 175506306
[(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl] carbamate (PubChem CID 175506306) has the molecular formula C10H23NO4Si and a molecular weight of 249.38 g/mol. Its IUPAC name is [(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl] carbamate.
| Compound Name | [(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl] carbamate |
|---|---|
| PubChem CID | 175506306 |
| Molecular Formula | C10H23NO4Si |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [(2R)-3-[tert-butyl(dimethyl)silyl]oxy-2-hydroxypropyl] carbamate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H](O)COC(N)=O |
| InChI | InChI=1S/C10H23NO4Si/c1-10(2,3)16(4,5)15-7-8(12)6-14-9(11)13/h8,12H,6-7H2,1-5H3,(H2,11,13)/t8-/m1/s1 |
| InChIKey | LWMWJNGIEAVILA-MRVPVSSYSA-N |
| XLogP | 1.46 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|