C11H23BrO4Si — CID 134934318
methyl (2R,3R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate (PubChem CID 134934318) has the molecular formula C11H23BrO4Si and a molecular weight of 327.29 g/mol. Its IUPAC name is methyl (2R,3R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate.
| Compound Name | methyl (2R,3R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate |
|---|---|
| PubChem CID | 134934318 |
| Molecular Formula | C11H23BrO4Si |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | methyl (2R,3R)-2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxybutanoate |
| SMILES | COC(=O)[C@H](Br)[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H23BrO4Si/c1-11(2,3)17(5,6)16-7-8(13)9(12)10(14)15-4/h8-9,13H,7H2,1-6H3/t8-,9-/m1/s1 |
| InChIKey | AMJZZGYRSONRIP-RKDXNWHRSA-N |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|