C17H34O4Si2 — CID 11199155
methyl (2S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-5-trimethylsilylpent-4-ynoate (PubChem CID 11199155) has the molecular formula C17H34O4Si2 and a molecular weight of 358.63 g/mol. Its IUPAC name is methyl (2S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-5-trimethylsilylpent-4-ynoate.
| Compound Name | methyl (2S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-5-trimethylsilylpent-4-ynoate |
|---|---|
| PubChem CID | 11199155 |
| Molecular Formula | C17H34O4Si2 |
| Molecular Weight | 358.63 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | methyl (2S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-5-trimethylsilylpent-4-ynoate |
| SMILES | COC(=O)[C@@H](CC#C[Si](C)(C)C)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O4Si2/c1-17(2,3)23(8,9)21-13-15(18)14(16(19)20-4)11-10-12-22(5,6)7/h14-15,18H,11,13H2,1-9H3/t14-,15-/m0/s1 |
| InChIKey | TZHLYYDEGYQFQG-GJZGRUSLSA-N |
| XLogP | 3.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|