C16H32O4Si2 — CID 87972498
(2S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-trimethylsilylpent-4-ynoic acid (PubChem CID 87972498) has the molecular formula C16H32O4Si2 and a molecular weight of 344.60 g/mol. Its IUPAC name is (2S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-trimethylsilylpent-4-ynoic acid.
| Compound Name | (2S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-trimethylsilylpent-4-ynoic acid |
|---|---|
| PubChem CID | 87972498 |
| Molecular Formula | C16H32O4Si2 |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (2S)-2-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyethyl]-3-trimethylsilylpent-4-ynoic acid |
| SMILES | C#CC([C@H](C(=O)O)[C@@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H32O4Si2/c1-10-13(21(5,6)7)14(15(18)19)12(17)11-20-22(8,9)16(2,3)4/h1,12-14,17H,11H2,2-9H3,(H,18,19)/t12-,13?,14+/m0/s1 |
| InChIKey | KIZKLNGWAIEMRH-SMEJFCCLSA-N |
| XLogP | 3.41 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|