C10H23IO3Si — CID 102271148
(2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobutane-1,3-diol (PubChem CID 102271148) has the molecular formula C10H23IO3Si and a molecular weight of 346.28 g/mol. Its IUPAC name is (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobutane-1,3-diol.
| Compound Name | (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobutane-1,3-diol |
|---|---|
| PubChem CID | 102271148 |
| Molecular Formula | C10H23IO3Si |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | (2S,3R)-4-[tert-butyl(dimethyl)silyl]oxy-2-iodobutane-1,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](I)CO |
| InChI | InChI=1S/C10H23IO3Si/c1-10(2,3)15(4,5)14-7-9(13)8(11)6-12/h8-9,12-13H,6-7H2,1-5H3/t8-,9+/m0/s1 |
| InChIKey | IVYJYADQIWIVSB-DTWKUNHWSA-N |
| XLogP | 2.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|