C18H42O5Si2 — CID 101252863
(2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(methoxymethoxy)butan-2-ol (PubChem CID 101252863) has the molecular formula C18H42O5Si2 and a molecular weight of 394.70 g/mol. Its IUPAC name is (2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(methoxymethoxy)butan-2-ol.
| Compound Name | (2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(methoxymethoxy)butan-2-ol |
|---|---|
| PubChem CID | 101252863 |
| Molecular Formula | C18H42O5Si2 |
| Molecular Weight | 394.70 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (2S,3S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3-(methoxymethoxy)butan-2-ol |
| SMILES | COCO[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H42O5Si2/c1-17(2,3)24(8,9)22-12-15(19)16(21-14-20-7)13-23-25(10,11)18(4,5)6/h15-16,19H,12-14H2,1-11H3/t15-,16-/m0/s1 |
| InChIKey | YNPUWYWVLMGLML-HOTGVXAUSA-N |
| XLogP | 4.38 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.70 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|