C16H36O4Si — CID 15280451
(3S,4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-ol (PubChem CID 15280451) has the molecular formula C16H36O4Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (3S,4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-ol.
| Compound Name | (3S,4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-ol |
|---|---|
| PubChem CID | 15280451 |
| Molecular Formula | C16H36O4Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (3S,4S,5R)-6-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-ol |
| SMILES | COCO[C@@H]([C@H](C)CO[Si](C)(C)C(C)(C)C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C16H36O4Si/c1-12(2)14(17)15(19-11-18-7)13(3)10-20-21(8,9)16(4,5)6/h12-15,17H,10-11H2,1-9H3/t13-,14+,15+/m1/s1 |
| InChIKey | FMERPPZXCLZHJI-ILXRZTDVSA-N |
| XLogP | 3.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|