C15H32O2Si2 — CID 71561744
(3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-trimethylsilylpent-1-yn-3-ol (PubChem CID 71561744) has the molecular formula C15H32O2Si2 and a molecular weight of 300.59 g/mol. Its IUPAC name is (3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-trimethylsilylpent-1-yn-3-ol.
| Compound Name | (3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-trimethylsilylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 71561744 |
| Molecular Formula | C15H32O2Si2 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | (3S,4S)-5-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-trimethylsilylpent-1-yn-3-ol |
| SMILES | C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C15H32O2Si2/c1-13(14(16)10-11-18(5,6)7)12-17-19(8,9)15(2,3)4/h13-14,16H,12H2,1-9H3/t13-,14+/m0/s1 |
| InChIKey | SMBDXSSABLBLNI-UONOGXRCSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|