C28H64O4Si3 — CID 71664998
(2R,3R,4S,6S,7S)-4,6,8-tris[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethyloctan-2-ol (PubChem CID 71664998) has the molecular formula C28H64O4Si3 and a molecular weight of 549.07 g/mol. Its IUPAC name is (2R,3R,4S,6S,7S)-4,6,8-tris[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethyloctan-2-ol.
| Compound Name | (2R,3R,4S,6S,7S)-4,6,8-tris[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethyloctan-2-ol |
|---|---|
| PubChem CID | 71664998 |
| Molecular Formula | C28H64O4Si3 |
| Molecular Weight | 549.07 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | (2R,3R,4S,6S,7S)-4,6,8-tris[[tert-butyl(dimethyl)silyl]oxy]-3,7-dimethyloctan-2-ol |
| SMILES | C[C@@H]([C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C28H64O4Si3/c1-21(20-30-33(13,14)26(4,5)6)24(31-34(15,16)27(7,8)9)19-25(22(2)23(3)29)32-35(17,18)28(10,11)12/h21-25,29H,19-20H2,1-18H3/t21-,22+,23+,24-,25-/m0/s1 |
| InChIKey | VBNDMPJFPNPWBJ-QVXKZJQXSA-N |
| XLogP | 8.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.07 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|