C15H34O2Si — CID 58012730
(3R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylheptan-3-ol (PubChem CID 58012730) has the molecular formula C15H34O2Si and a molecular weight of 274.52 g/mol. Its IUPAC name is (3R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylheptan-3-ol.
| Compound Name | (3R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylheptan-3-ol |
|---|---|
| PubChem CID | 58012730 |
| Molecular Formula | C15H34O2Si |
| Molecular Weight | 274.52 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (3R)-5-[tert-butyl(dimethyl)silyl]oxy-2,6-dimethylheptan-3-ol |
| SMILES | CC(C)C(C[C@@H](O)C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H34O2Si/c1-11(2)13(16)10-14(12(3)4)17-18(8,9)15(5,6)7/h11-14,16H,10H2,1-9H3/t13-,14?/m1/s1 |
| InChIKey | IRXRADPAZAKHAW-KWCCSABGSA-N |
| XLogP | 4.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|