C18H40O2Si — CID 132501473
(5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2,5,8-trimethylnonan-2-ol (PubChem CID 132501473) has the molecular formula C18H40O2Si and a molecular weight of 316.60 g/mol. Its IUPAC name is (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2,5,8-trimethylnonan-2-ol.
| Compound Name | (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2,5,8-trimethylnonan-2-ol |
|---|---|
| PubChem CID | 132501473 |
| Molecular Formula | C18H40O2Si |
| Molecular Weight | 316.60 g/mol |
| Exact Mass | 316.28 |
| IUPAC Name | (5S,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2,5,8-trimethylnonan-2-ol |
| SMILES | CC(C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CCC(C)(C)O |
| InChI | InChI=1S/C18H40O2Si/c1-14(2)13-16(15(3)11-12-18(7,8)19)20-21(9,10)17(4,5)6/h14-16,19H,11-13H2,1-10H3/t15-,16-/m0/s1 |
| InChIKey | JSRQBCYIXBBTSN-HOTGVXAUSA-N |
| XLogP | 5.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|