C14H30O4Si — CID 15469389
(5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6-methylheptanoic acid (PubChem CID 15469389) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6-methylheptanoic acid.
| Compound Name | (5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6-methylheptanoic acid |
|---|---|
| PubChem CID | 15469389 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-6-methylheptanoic acid |
| SMILES | C[C@@H](CO)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O4Si/c1-11(10-15)12(8-7-9-13(16)17)18-19(5,6)14(2,3)4/h11-12,15H,7-10H2,1-6H3,(H,16,17)/t11-,12+/m0/s1 |
| InChIKey | WCBNOYPSNARZCL-NWDGAFQWSA-N |
| XLogP | 3.26 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|