C13H25IO3Si — CID 11188272
(E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-4-methylhex-5-enoic acid (PubChem CID 11188272) has the molecular formula C13H25IO3Si and a molecular weight of 384.33 g/mol. Its IUPAC name is (E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-4-methylhex-5-enoic acid.
| Compound Name | (E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-4-methylhex-5-enoic acid |
|---|---|
| PubChem CID | 11188272 |
| Molecular Formula | C13H25IO3Si |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (E,3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-4-methylhex-5-enoic acid |
| SMILES | C[C@H](/C=C/I)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25IO3Si/c1-10(7-8-14)11(9-12(15)16)17-18(5,6)13(2,3)4/h7-8,10-11H,9H2,1-6H3,(H,15,16)/b8-7+/t10-,11+/m1/s1 |
| InChIKey | MKENLGATCOUQSX-SFEFJYQLSA-N |
| XLogP | 4.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|