C23H44O5Si — CID 101484701
(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S,6R)-2,2,5-trimethyl-6-[(2S)-pent-4-en-2-yl]-1,3-dioxan-4-yl]pentanoic acid (PubChem CID 101484701) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S,6R)-2,2,5-trimethyl-6-[(2S)-pent-4-en-2-yl]-1,3-dioxan-4-yl]pentanoic acid.
| Compound Name | (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S,6R)-2,2,5-trimethyl-6-[(2S)-pent-4-en-2-yl]-1,3-dioxan-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 101484701 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | (3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S,6R)-2,2,5-trimethyl-6-[(2S)-pent-4-en-2-yl]-1,3-dioxan-4-yl]pentanoic acid |
| SMILES | C=CC[C@H](C)[C@H]1OC(C)(C)O[C@@H]([C@@H](C)[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)[C@H]1C |
| InChI | InChI=1S/C23H44O5Si/c1-12-13-15(2)20-17(4)21(27-23(8,9)26-20)16(3)18(14-19(24)25)28-29(10,11)22(5,6)7/h12,15-18,20-21H,1,13-14H2,2-11H3,(H,24,25)/t15-,16-,17-,18+,20+,21-/m0/s1 |
| InChIKey | HCNZRDLUPZHERQ-XUJUZBCESA-N |
| XLogP | 5.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|