C35H70O5SiSn — CID 46211632
(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S,6R)-2,2,5-trimethyl-6-[(E,2S)-5-tributylstannylpent-4-en-2-yl]-1,3-dioxan-4-yl]pentanoic acid (PubChem CID 46211632) has the molecular formula C35H70O5SiSn and a molecular weight of 717.74 g/mol. Its IUPAC name is (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S,6R)-2,2,5-trimethyl-6-[(E,2S)-5-tributylstannylpent-4-en-2-yl]-1,3-dioxan-4-yl]pentanoic acid.
| Compound Name | (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S,6R)-2,2,5-trimethyl-6-[(E,2S)-5-tributylstannylpent-4-en-2-yl]-1,3-dioxan-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 46211632 |
| Molecular Formula | C35H70O5SiSn |
| Molecular Weight | 717.74 g/mol |
| Exact Mass | 718.40 |
| IUPAC Name | (3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(4R,5S,6R)-2,2,5-trimethyl-6-[(E,2S)-5-tributylstannylpent-4-en-2-yl]-1,3-dioxan-4-yl]pentanoic acid |
| SMILES | CCCC[Sn](/C=C/C[C@H](C)[C@H]1OC(C)(C)O[C@@H]([C@H](C)[C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)[C@H]1C)(CCCC)CCCC |
| InChI | InChI=1S/C23H43O5Si.3C4H9.Sn/c1-12-13-15(2)20-17(4)21(27-23(8,9)26-20)16(3)18(14-19(24)25)28-29(10,11)22(5,6)7;3*1-3-4-2;/h1,12,15-18,20-21H,13-14H2,2-11H3,(H,24,25);3*1,3-4H2,2H3;/t15-,16+,17-,18+,20+,21-;;;;/m0..../s1 |
| InChIKey | YYOIJARIVXMORX-HLXOLMJWSA-N |
| XLogP | 10.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.74 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|