C26H54O3SiSn — CID 57407910
methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-tributylstannylhept-6-enoate (PubChem CID 57407910) has the molecular formula C26H54O3SiSn and a molecular weight of 561.51 g/mol. Its IUPAC name is methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-tributylstannylhept-6-enoate.
| Compound Name | methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-tributylstannylhept-6-enoate |
|---|---|
| PubChem CID | 57407910 |
| Molecular Formula | C26H54O3SiSn |
| Molecular Weight | 561.51 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | methyl (E,5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-tributylstannylhept-6-enoate |
| SMILES | CCCC[Sn](/C=C/[C@H](CCCC(=O)OC)O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C14H27O3Si.3C4H9.Sn/c1-8-12(10-9-11-13(15)16-5)17-18(6,7)14(2,3)4;3*1-3-4-2;/h1,8,12H,9-11H2,2-7H3;3*1,3-4H2,2H3;/t12-;;;;/m1..../s1 |
| InChIKey | DOTKSSXITJUXTF-HHUWXINPSA-N |
| XLogP | 8.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.51 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|