C27H56O4Si2 — CID 10006194
methyl (E,10S,13S)-10,13-bis(trimethylsilyloxy)icos-11-enoate (PubChem CID 10006194) has the molecular formula C27H56O4Si2 and a molecular weight of 500.91 g/mol. Its IUPAC name is methyl (E,10S,13S)-10,13-bis(trimethylsilyloxy)icos-11-enoate.
| Compound Name | methyl (E,10S,13S)-10,13-bis(trimethylsilyloxy)icos-11-enoate |
|---|---|
| PubChem CID | 10006194 |
| Molecular Formula | C27H56O4Si2 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | methyl (E,10S,13S)-10,13-bis(trimethylsilyloxy)icos-11-enoate |
| SMILES | CCCCCCC[C@@H](/C=C/[C@H](CCCCCCCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C27H56O4Si2/c1-9-10-11-14-17-20-25(30-32(3,4)5)23-24-26(31-33(6,7)8)21-18-15-12-13-16-19-22-27(28)29-2/h23-26H,9-22H2,1-8H3/b24-23+/t25-,26-/m0/s1 |
| InChIKey | AZLICHDMRSAXCY-MGHSJVFESA-N |
| XLogP | 8.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|