C28H62O5Si3 — CID 71372132
methyl 9,10,12-tris(trimethylsilyloxy)octadecanoate (PubChem CID 71372132) has the molecular formula C28H62O5Si3 and a molecular weight of 563.06 g/mol. Its IUPAC name is methyl 9,10,12-tris(trimethylsilyloxy)octadecanoate.
| Compound Name | methyl 9,10,12-tris(trimethylsilyloxy)octadecanoate |
|---|---|
| PubChem CID | 71372132 |
| Molecular Formula | C28H62O5Si3 |
| Molecular Weight | 563.06 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | methyl 9,10,12-tris(trimethylsilyloxy)octadecanoate |
| SMILES | CCCCCCC(CC(O[Si](C)(C)C)C(CCCCCCCC(=O)OC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C28H62O5Si3/c1-12-13-14-18-21-25(31-34(3,4)5)24-27(33-36(9,10)11)26(32-35(6,7)8)22-19-16-15-17-20-23-28(29)30-2/h25-27H,12-24H2,1-11H3 |
| InChIKey | KSUUHGPVNFXSTL-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.06 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|