C27H60O5Si3 — CID 162911043
methyl (6S,7S,16S)-6,7,16-tris(trimethylsilyloxy)heptadecanoate (PubChem CID 162911043) has the molecular formula C27H60O5Si3 and a molecular weight of 549.03 g/mol. Its IUPAC name is methyl (6S,7S,16S)-6,7,16-tris(trimethylsilyloxy)heptadecanoate.
| Compound Name | methyl (6S,7S,16S)-6,7,16-tris(trimethylsilyloxy)heptadecanoate |
|---|---|
| PubChem CID | 162911043 |
| Molecular Formula | C27H60O5Si3 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.37 |
| IUPAC Name | methyl (6S,7S,16S)-6,7,16-tris(trimethylsilyloxy)heptadecanoate |
| SMILES | COC(=O)CCCC[C@H](O[Si](C)(C)C)[C@H](CCCCCCCC[C@H](C)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C27H60O5Si3/c1-24(30-33(3,4)5)20-16-14-12-13-15-17-21-25(31-34(6,7)8)26(32-35(9,10)11)22-18-19-23-27(28)29-2/h24-26H,12-23H2,1-11H3/t24-,25-,26-/m0/s1 |
| InChIKey | VZFQQOXLVSMGOB-GSDHBNRESA-N |
| XLogP | 8.52 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|