C24H52O2Si2 — CID 10025621
trimethyl-[(E,6S,9R)-9-trimethylsilyloxyoctadec-7-en-6-yl]oxysilane (PubChem CID 10025621) has the molecular formula C24H52O2Si2 and a molecular weight of 428.85 g/mol. Its IUPAC name is trimethyl-[(E,6S,9R)-9-trimethylsilyloxyoctadec-7-en-6-yl]oxysilane.
| Compound Name | trimethyl-[(E,6S,9R)-9-trimethylsilyloxyoctadec-7-en-6-yl]oxysilane |
|---|---|
| PubChem CID | 10025621 |
| Molecular Formula | C24H52O2Si2 |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.35 |
| IUPAC Name | trimethyl-[(E,6S,9R)-9-trimethylsilyloxyoctadec-7-en-6-yl]oxysilane |
| SMILES | CCCCCCCCC[C@H](/C=C/[C@H](CCCCC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C24H52O2Si2/c1-9-11-13-14-15-16-18-20-24(26-28(6,7)8)22-21-23(19-17-12-10-2)25-27(3,4)5/h21-24H,9-20H2,1-8H3/b22-21+/t23-,24+/m0/s1 |
| InChIKey | MYNANBRDMWPWRG-QIPPOJDDSA-N |
| XLogP | 8.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|